C30H46N4O4S — CID 67037953
1-butyl-3-hexyl-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea (PubChem CID 67037953) has the molecular formula C30H46N4O4S and a molecular weight of 558.79 g/mol. Its IUPAC name is 1-butyl-3-hexyl-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea.
| Compound Name | 1-butyl-3-hexyl-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 67037953 |
| Molecular Formula | C30H46N4O4S |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 1-butyl-3-hexyl-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea |
| SMILES | CCCCCCNC(=O)N(CCCC)C1CCN(Cc2ccc(Oc3ccc(NS(C)(=O)=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H46N4O4S/c1-4-6-8-9-20-31-30(35)34(21-7-5-2)27-18-22-33(23-19-27)24-25-10-14-28(15-11-25)38-29-16-12-26(13-17-29)32-39(3,36)37/h10-17,27,32H,4-9,18-24H2,1-3H3,(H,31,35) |
| InChIKey | CDWGMLJWXGBDIL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|