C29H45ClN4O4S — CID 67038536
1-butyl-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-3-pentylurea;hydrochloride (PubChem CID 67038536) has the molecular formula C29H45ClN4O4S and a molecular weight of 581.22 g/mol. Its IUPAC name is 1-butyl-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-3-pentylurea;hydrochloride.
| Compound Name | 1-butyl-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-3-pentylurea;hydrochloride |
|---|---|
| PubChem CID | 67038536 |
| Molecular Formula | C29H45ClN4O4S |
| Molecular Weight | 581.22 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | 1-butyl-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-3-pentylurea;hydrochloride |
| SMILES | CCCCCNC(=O)N(CCCC)C1CCN(Cc2ccc(Oc3ccc(NS(C)(=O)=O)cc3)cc2)CC1.Cl |
| InChI | InChI=1S/C29H44N4O4S.ClH/c1-4-6-8-19-30-29(34)33(20-7-5-2)26-17-21-32(22-18-26)23-24-9-13-27(14-10-24)37-28-15-11-25(12-16-28)31-38(3,35)36;/h9-16,26,31H,4-8,17-23H2,1-3H3,(H,30,34);1H |
| InChIKey | GFYYJUOQLOHPFV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.22 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|