C30H38N4O6S — CID 67038036
1-butyl-3-(3,4-dihydroxyphenyl)-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea (PubChem CID 67038036) has the molecular formula C30H38N4O6S and a molecular weight of 582.72 g/mol. Its IUPAC name is 1-butyl-3-(3,4-dihydroxyphenyl)-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea.
| Compound Name | 1-butyl-3-(3,4-dihydroxyphenyl)-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 67038036 |
| Molecular Formula | C30H38N4O6S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 1-butyl-3-(3,4-dihydroxyphenyl)-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea |
| SMILES | CCCCN(C(=O)Nc1ccc(O)c(O)c1)C1CCN(Cc2ccc(Oc3ccc(NS(C)(=O)=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H38N4O6S/c1-3-4-17-34(30(37)31-24-9-14-28(35)29(36)20-24)25-15-18-33(19-16-25)21-22-5-10-26(11-6-22)40-27-12-7-23(8-13-27)32-41(2,38)39/h5-14,20,25,32,35-36H,3-4,15-19,21H2,1-2H3,(H,31,37) |
| InChIKey | TXXMHLFPTYUHQL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|