C31H38F2N4O4S — CID 67038519
4-[butyl-[(2,4-difluorophenyl)carbamoyl]amino]-1-[[4-[[4-[(sulfinoamino)methyl]phenyl]methoxy]phenyl]methyl]piperidine (PubChem CID 67038519) has the molecular formula C31H38F2N4O4S and a molecular weight of 600.73 g/mol. Its IUPAC name is 4-[butyl-[(2,4-difluorophenyl)carbamoyl]amino]-1-[[4-[[4-[(sulfinoamino)methyl]phenyl]methoxy]phenyl]methyl]piperidine.
| Compound Name | 4-[butyl-[(2,4-difluorophenyl)carbamoyl]amino]-1-[[4-[[4-[(sulfinoamino)methyl]phenyl]methoxy]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 67038519 |
| Molecular Formula | C31H38F2N4O4S |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 4-[butyl-[(2,4-difluorophenyl)carbamoyl]amino]-1-[[4-[[4-[(sulfinoamino)methyl]phenyl]methoxy]phenyl]methyl]piperidine |
| SMILES | CCCCN(C(=O)Nc1ccc(F)cc1F)C1CCN(Cc2ccc(OCc3ccc(CNS(=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H38F2N4O4S/c1-2-3-16-37(31(38)35-30-13-10-26(32)19-29(30)33)27-14-17-36(18-15-27)21-24-8-11-28(12-9-24)41-22-25-6-4-23(5-7-25)20-34-42(39)40/h4-13,19,27,34H,2-3,14-18,20-22H2,1H3,(H,35,38)(H,39,40) |
| InChIKey | MNVDGWMQAASNHC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|