C22H28F2N4O — CID 151280173
1-butyl-3-(2,4-difluorophenyl)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]urea (PubChem CID 151280173) has the molecular formula C22H28F2N4O and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-butyl-3-(2,4-difluorophenyl)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]urea.
| Compound Name | 1-butyl-3-(2,4-difluorophenyl)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 151280173 |
| Molecular Formula | C22H28F2N4O |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-butyl-3-(2,4-difluorophenyl)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]urea |
| SMILES | CCCCN(C(=O)Nc1ccc(F)cc1F)C1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C22H28F2N4O/c1-2-3-11-28(22(29)26-21-7-6-18(23)14-20(21)24)19-8-12-27(13-9-19)16-17-5-4-10-25-15-17/h4-7,10,14-15,19H,2-3,8-9,11-13,16H2,1H3,(H,26,29) |
| InChIKey | NYEXMIRBVOWUJR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |