[2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate

C20H23NO5 — CID 18073894

IUPAC[2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate
SMILESCCN(Cc1ccccc1)C(=O)COC(=O)c1cc(OC)cc(OC)c1
InChIInChI=1S/C20H23NO5/c1-4-21(13-15-8-6-5-7-9-15)19(22)14-26-20(23)16-10-17(24-2)12-18(11-16)25-3/h5-12H,4,13-14H2,1-3H3
InChIKeyXMBMZQMXTSMCFT-UHFFFAOYSA-N
MW357.41 g/mol
LogP2.91
Rot. Bonds8

About [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate

[2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate (PubChem CID 18073894) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate.

Molecular Properties

Compound Name[2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate
PubChem CID18073894
Molecular FormulaC20H23NO5
Molecular Weight357.41 g/mol
Exact Mass357.16
IUPAC Name[2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate
SMILESCCN(Cc1ccccc1)C(=O)COC(=O)c1cc(OC)cc(OC)c1
InChIInChI=1S/C20H23NO5/c1-4-21(13-15-8-6-5-7-9-15)19(22)14-26-20(23)16-10-17(24-2)12-18(11-16)25-3/h5-12H,4,13-14H2,1-3H3
InChIKeyXMBMZQMXTSMCFT-UHFFFAOYSA-N
XLogP2.91
TPSA65.07 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500357.41
LogP ≤ 52.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate?
The IUPAC name of [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate (CID 18073894) is [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate.
What is the SMILES notation for [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate?
The canonical SMILES for [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate is CCN(Cc1ccccc1)C(=O)COC(=O)c1cc(OC)cc(OC)c1.
What is the InChIKey of [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate?
The InChIKey is XMBMZQMXTSMCFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO5/c1-4-21(13-15-8-6-5-7-9-15)19(22)14-26-20(23)16-10-17(24-2)12-18(11-16)25-3/h5-12H,4,13-14H2,1-3H3.
What are the key properties of [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate?
[2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate has a molecular weight of 357.41 g/mol, XLogP of 2.91, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[benzyl(ethyl)amino]-2-oxoethyl] 3,5-dimethoxybenzoate is sourced from PubChem (CID 18073894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).