C24H22ClNO6S — CID 42990147
(4-oxo-4-thiophen-2-ylbutyl) 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate (PubChem CID 42990147) has the molecular formula C24H22ClNO6S and a molecular weight of 487.96 g/mol. Its IUPAC name is (4-oxo-4-thiophen-2-ylbutyl) 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate.
| Compound Name | (4-oxo-4-thiophen-2-ylbutyl) 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 42990147 |
| Molecular Formula | C24H22ClNO6S |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (4-oxo-4-thiophen-2-ylbutyl) 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate |
| SMILES | COc1cc(NC(=O)c2ccccc2Cl)c(C(=O)OCCCC(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C24H22ClNO6S/c1-30-20-13-16(24(29)32-11-5-9-19(27)22-10-6-12-33-22)18(14-21(20)31-2)26-23(28)15-7-3-4-8-17(15)25/h3-4,6-8,10,12-14H,5,9,11H2,1-2H3,(H,26,28) |
| InChIKey | WYORKPKPOJTXAB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|