C20H21ClN2O7 — CID 41279847
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-acetamido-4,5-dimethoxybenzoate (PubChem CID 41279847) has the molecular formula C20H21ClN2O7 and a molecular weight of 436.85 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-acetamido-4,5-dimethoxybenzoate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-acetamido-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 41279847 |
| Molecular Formula | C20H21ClN2O7 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-acetamido-4,5-dimethoxybenzoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)c1cc(OC)c(OC)cc1NC(C)=O |
| InChI | InChI=1S/C20H21ClN2O7/c1-11(24)22-14-9-18(29-4)17(28-3)8-13(14)20(26)30-10-19(25)23-15-7-12(21)5-6-16(15)27-2/h5-9H,10H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | RAAFCMFXMRZSLV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |