C19H20ClNO6 — CID 55311311
2-(3-chlorophenoxy)ethyl 2-acetamido-4,5-dimethoxybenzoate (PubChem CID 55311311) has the molecular formula C19H20ClNO6 and a molecular weight of 393.82 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 2-acetamido-4,5-dimethoxybenzoate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 2-acetamido-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 55311311 |
| Molecular Formula | C19H20ClNO6 |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 2-acetamido-4,5-dimethoxybenzoate |
| SMILES | COc1cc(NC(C)=O)c(C(=O)OCCOc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C19H20ClNO6/c1-12(22)21-16-11-18(25-3)17(24-2)10-15(16)19(23)27-8-7-26-14-6-4-5-13(20)9-14/h4-6,9-11H,7-8H2,1-3H3,(H,21,22) |
| InChIKey | HMKXXMKIFOIDJC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|