C18H17ClO6 — CID 33419624
2-(3-chlorophenoxy)ethyl 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 33419624) has the molecular formula C18H17ClO6 and a molecular weight of 364.78 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 33419624 |
| Molecular Formula | C18H17ClO6 |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | COc1cc(C(=O)OCCOc2cccc(Cl)c2)cc2c1OCCO2 |
| InChI | InChI=1S/C18H17ClO6/c1-21-15-9-12(10-16-17(15)24-7-6-23-16)18(20)25-8-5-22-14-4-2-3-13(19)11-14/h2-4,9-11H,5-8H2,1H3 |
| InChIKey | ADJLEJYDTHOUIV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|