C17H16N2O5S — CID 25434917
2-(4-cyanophenoxy)ethyl 4-methyl-3-sulfamoylbenzoate (PubChem CID 25434917) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 4-methyl-3-sulfamoylbenzoate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 4-methyl-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 25434917 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 4-methyl-3-sulfamoylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCOc2ccc(C#N)cc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H16N2O5S/c1-12-2-5-14(10-16(12)25(19,21)22)17(20)24-9-8-23-15-6-3-13(11-18)4-7-15/h2-7,10H,8-9H2,1H3,(H2,19,21,22) |
| InChIKey | DHVYYUDFGGOZJR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|