C24H30O5 — CID 4651860
[2-(1-adamantyl)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate (PubChem CID 4651860) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 4651860 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate |
| SMILES | O=C(OCC(=O)C12CC3CC(CC(C3)C1)C2)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C24H30O5/c25-22(24-11-16-8-17(12-24)10-18(9-16)13-24)15-29-23(26)19-3-5-20(6-4-19)28-14-21-2-1-7-27-21/h3-6,16-18,21H,1-2,7-15H2 |
| InChIKey | SADHTSRMZPNVNX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |