C21H21ClO6 — CID 7488547
[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate (PubChem CID 7488547) has the molecular formula C21H21ClO6 and a molecular weight of 404.85 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | [2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 7488547 |
| Molecular Formula | C21H21ClO6 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(OC[C@H]3CCCO3)cc2)cc1Cl |
| InChI | InChI=1S/C21H21ClO6/c1-25-20-9-6-15(11-18(20)22)19(23)13-28-21(24)14-4-7-16(8-5-14)27-12-17-3-2-10-26-17/h4-9,11,17H,2-3,10,12-13H2,1H3/t17-/m1/s1 |
| InChIKey | ZBMNQMNMDPWQOD-QGZVFWFLSA-N |
| XLogP | 3.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |