C20H19Cl2NO5 — CID 46793982
[2-(2,3-dichloroanilino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate (PubChem CID 46793982) has the molecular formula C20H19Cl2NO5 and a molecular weight of 424.28 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 46793982 |
| Molecular Formula | C20H19Cl2NO5 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate |
| SMILES | O=C(COC(=O)c1ccc(OCC2CCCO2)cc1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H19Cl2NO5/c21-16-4-1-5-17(19(16)22)23-18(24)12-28-20(25)13-6-8-14(9-7-13)27-11-15-3-2-10-26-15/h1,4-9,15H,2-3,10-12H2,(H,23,24) |
| InChIKey | GIRVWQMJVFVHJR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |