C20H19F2NO5 — CID 2559601
[2-(2,6-difluoroanilino)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate (PubChem CID 2559601) has the molecular formula C20H19F2NO5 and a molecular weight of 391.37 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 2559601 |
| Molecular Formula | C20H19F2NO5 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
| SMILES | O=C(COC(=O)c1ccc(OC[C@H]2CCCO2)cc1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C20H19F2NO5/c21-16-4-1-5-17(22)19(16)23-18(24)12-28-20(25)13-6-8-14(9-7-13)27-11-15-3-2-10-26-15/h1,4-9,15H,2-3,10-12H2,(H,23,24)/t15-/m1/s1 |
| InChIKey | NWMGNRORJJWBFU-OAHLLOKOSA-N |
| XLogP | 3.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |