C18H17BrO5S — CID 2626007
[2-(5-bromothiophen-2-yl)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate (PubChem CID 2626007) has the molecular formula C18H17BrO5S and a molecular weight of 425.30 g/mol. Its IUPAC name is [2-(5-bromothiophen-2-yl)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | [2-(5-bromothiophen-2-yl)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 2626007 |
| Molecular Formula | C18H17BrO5S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | [2-(5-bromothiophen-2-yl)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
| SMILES | O=C(OCC(=O)c1ccc(Br)s1)c1ccc(OC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C18H17BrO5S/c19-17-8-7-16(25-17)15(20)11-24-18(21)12-3-5-13(6-4-12)23-10-14-2-1-9-22-14/h3-8,14H,1-2,9-11H2/t14-/m1/s1 |
| InChIKey | RNOCDRLAZHWOJJ-CQSZACIVSA-N |
| XLogP | 4.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |