C23H24O4 — CID 3964452
[2-(1-adamantyl)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 3964452) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 3964452 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCC(=O)C12CC3CC(CC(C3)C1)C2)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C23H24O4/c24-20-9-18-4-2-1-3-17(18)8-19(20)22(26)27-13-21(25)23-10-14-5-15(11-23)7-16(6-14)12-23/h1-4,8-9,14-16,24H,5-7,10-13H2 |
| InChIKey | VCAXUOUFTQBZQJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |