C19H23NO4 — CID 7485849
[2-[di(propan-2-yl)amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 7485849) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7485849 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | CC(C)N(C(=O)COC(=O)c1cc2ccccc2cc1O)C(C)C |
| InChI | InChI=1S/C19H23NO4/c1-12(2)20(13(3)4)18(22)11-24-19(23)16-9-14-7-5-6-8-15(14)10-17(16)21/h5-10,12-13,21H,11H2,1-4H3 |
| InChIKey | HYCWXWPSUINUCV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |