C23H23NO4S — CID 7891009
[(2R)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 7891009) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is [(2R)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [(2R)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7891009 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [(2R)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | Cc1cc(C(=O)[C@@H](C)OC(=O)CCC(=O)c2cccs2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C23H23NO4S/c1-15-14-19(16(2)24(15)18-8-5-4-6-9-18)23(27)17(3)28-22(26)12-11-20(25)21-10-7-13-29-21/h4-10,13-14,17H,11-12H2,1-3H3/t17-/m1/s1 |
| InChIKey | QREOZFCINBLFAQ-QGZVFWFLSA-N |
| XLogP | 4.93 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|