C24H22FNO3 — CID 7275169
[(2R)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7275169) has the molecular formula C24H22FNO3 and a molecular weight of 391.44 g/mol. Its IUPAC name is [(2R)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7275169 |
| Molecular Formula | C24H22FNO3 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [(2R)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | Cc1cc(C(=O)[C@@H](C)OC(=O)/C=C/c2ccccc2F)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H22FNO3/c1-16-15-21(17(2)26(16)20-10-5-4-6-11-20)24(28)18(3)29-23(27)14-13-19-9-7-8-12-22(19)25/h4-15,18H,1-3H3/b14-13+/t18-/m1/s1 |
| InChIKey | ZTXLKYAKFVFQKS-KAUXGEHWSA-N |
| XLogP | 5.06 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|