C21H19FO3 — CID 7485349
[(2R)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7485349) has the molecular formula C21H19FO3 and a molecular weight of 338.38 g/mol. Its IUPAC name is [(2R)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7485349 |
| Molecular Formula | C21H19FO3 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [(2R)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccccc1F)C(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C21H19FO3/c1-14(21(24)18-10-9-15-6-4-7-17(15)13-18)25-20(23)12-11-16-5-2-3-8-19(16)22/h2-3,5,8-14H,4,6-7H2,1H3/b12-11+/t14-/m1/s1 |
| InChIKey | DETWPXYFQCMSBW-GCZGRYASSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|