C22H22O5 — CID 7765964
[(2S)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 7765964) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7765964 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [(2S)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C)C(=O)c2ccc3c(c2)CCC3)ccc1O |
| InChI | InChI=1S/C22H22O5/c1-14(22(25)18-9-8-16-4-3-5-17(16)13-18)27-21(24)11-7-15-6-10-19(23)20(12-15)26-2/h6-14,23H,3-5H2,1-2H3/b11-7+/t14-/m0/s1 |
| InChIKey | PPQBKMXLIXYRKI-OIOXUXFSSA-N |
| XLogP | 3.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|