C20H18F2O6 — CID 8663464
[(2S)-1-[4-(difluoromethoxy)phenyl]-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 8663464) has the molecular formula C20H18F2O6 and a molecular weight of 392.35 g/mol. Its IUPAC name is [(2S)-1-[4-(difluoromethoxy)phenyl]-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-[4-(difluoromethoxy)phenyl]-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8663464 |
| Molecular Formula | C20H18F2O6 |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [(2S)-1-[4-(difluoromethoxy)phenyl]-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C)C(=O)c2ccc(OC(F)F)cc2)ccc1O |
| InChI | InChI=1S/C20H18F2O6/c1-12(19(25)14-5-7-15(8-6-14)28-20(21)22)27-18(24)10-4-13-3-9-16(23)17(11-13)26-2/h3-12,20,23H,1-2H3/b10-4+/t12-/m0/s1 |
| InChIKey | GDRGICZDLVDQPI-YCGNWBHESA-N |
| XLogP | 3.83 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|