C23H22FNO3S — CID 7225140
[(2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 7225140) has the molecular formula C23H22FNO3S and a molecular weight of 411.50 g/mol. Its IUPAC name is [(2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [(2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7225140 |
| Molecular Formula | C23H22FNO3S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [(2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | Cc1cc(C(=O)[C@H](C)OC(=O)CSc2ccccc2F)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C23H22FNO3S/c1-15-13-19(16(2)25(15)18-9-5-4-6-10-18)23(27)17(3)28-22(26)14-29-21-12-8-7-11-20(21)24/h4-13,17H,14H2,1-3H3/t17-/m0/s1 |
| InChIKey | QYUPFDKSUFVGPU-KRWDZBQOSA-N |
| XLogP | 5.14 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|