C19H16FNO3S — CID 7676157
[(2S)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 7676157) has the molecular formula C19H16FNO3S and a molecular weight of 357.41 g/mol. Its IUPAC name is [(2S)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [(2S)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7676157 |
| Molecular Formula | C19H16FNO3S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [(2S)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | C[C@H](OC(=O)CSc1ccccc1F)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H16FNO3S/c1-12(19(23)14-10-21-16-8-4-2-6-13(14)16)24-18(22)11-25-17-9-5-3-7-15(17)20/h2-10,12,21H,11H2,1H3/t12-/m0/s1 |
| InChIKey | SMFDPTFMMCGZMS-LBPRGKRZSA-N |
| XLogP | 4.21 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |