C19H16FNO4 — CID 8914367
[(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(3-fluorophenoxy)acetate (PubChem CID 8914367) has the molecular formula C19H16FNO4 and a molecular weight of 341.34 g/mol. Its IUPAC name is [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(3-fluorophenoxy)acetate.
| Compound Name | [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(3-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8914367 |
| Molecular Formula | C19H16FNO4 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(3-fluorophenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1cccc(F)c1)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H16FNO4/c1-12(19(23)16-10-21-17-8-3-2-7-15(16)17)25-18(22)11-24-14-6-4-5-13(20)9-14/h2-10,12,21H,11H2,1H3/t12-/m1/s1 |
| InChIKey | UIAJHIWGDNJKJH-GFCCVEGCSA-N |
| XLogP | 3.50 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |