C22H20ClNO3 — CID 7866458
[(2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 2-chlorobenzoate (PubChem CID 7866458) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is [(2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 2-chlorobenzoate.
| Compound Name | [(2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 7866458 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | [(2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-oxopropan-2-yl] 2-chlorobenzoate |
| SMILES | Cc1cc(C(=O)[C@H](C)OC(=O)c2ccccc2Cl)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H20ClNO3/c1-14-13-19(15(2)24(14)17-9-5-4-6-10-17)21(25)16(3)27-22(26)18-11-7-8-12-20(18)23/h4-13,16H,1-3H3/t16-/m0/s1 |
| InChIKey | BFTMASYMHVRPMO-INIZCTEOSA-N |
| XLogP | 5.18 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|