C21H19ClN2O3 — CID 2626216
[(2R)-1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] pyridine-4-carboxylate (PubChem CID 2626216) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is [(2R)-1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] pyridine-4-carboxylate.
| Compound Name | [(2R)-1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 2626216 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [(2R)-1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] pyridine-4-carboxylate |
| SMILES | Cc1cc(C(=O)[C@@H](C)OC(=O)c2ccncc2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN2O3/c1-13-12-19(14(2)24(13)18-6-4-17(22)5-7-18)20(25)15(3)27-21(26)16-8-10-23-11-9-16/h4-12,15H,1-3H3/t15-/m1/s1 |
| InChIKey | DTXBRKVHNLKGSJ-OAHLLOKOSA-N |
| XLogP | 4.57 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|