C21H18FNO3S — CID 7274868
1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone (PubChem CID 7274868) has the molecular formula C21H18FNO3S and a molecular weight of 383.44 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 7274868 |
| Molecular Formula | C21H18FNO3S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone |
| SMILES | Cc1cc(C(=O)CSc2ccccc2F)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H18FNO3S/c1-13-9-16(18(24)11-27-21-6-4-3-5-17(21)22)14(2)23(13)15-7-8-19-20(10-15)26-12-25-19/h3-10H,11-12H2,1-2H3 |
| InChIKey | CKDHZVOJDOVXGQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|