C21H16Cl2N4O3S — CID 5202912
1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]ethanone (PubChem CID 5202912) has the molecular formula C21H16Cl2N4O3S and a molecular weight of 475.36 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 5202912 |
| Molecular Formula | C21H16Cl2N4O3S |
| Molecular Weight | 475.36 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]ethanone |
| SMILES | Cc1cc(C(=O)CSc2nnc3c(Cl)cc(Cl)cn23)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H16Cl2N4O3S/c1-11-5-15(12(2)27(11)14-3-4-18-19(7-14)30-10-29-18)17(28)9-31-21-25-24-20-16(23)6-13(22)8-26(20)21/h3-8H,9-10H2,1-2H3 |
| InChIKey | YTTGRQALDKPECB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.36 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|