C27H29N3O3S — CID 4967144
1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2-pentylsulfanylbenzimidazol-1-yl)ethanone (PubChem CID 4967144) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2-pentylsulfanylbenzimidazol-1-yl)ethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2-pentylsulfanylbenzimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 4967144 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2-pentylsulfanylbenzimidazol-1-yl)ethanone |
| SMILES | CCCCCSc1nc2ccccc2n1CC(=O)c1cc(C)n(-c2ccc3c(c2)OCO3)c1C |
| InChI | InChI=1S/C27H29N3O3S/c1-4-5-8-13-34-27-28-22-9-6-7-10-23(22)29(27)16-24(31)21-14-18(2)30(19(21)3)20-11-12-25-26(15-20)33-17-32-25/h6-7,9-12,14-15H,4-5,8,13,16-17H2,1-3H3 |
| InChIKey | WLUMFZCBSCSQTB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|