C27H25N5O3S — CID 6409303
1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrol-3-yl]-2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone (PubChem CID 6409303) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrol-3-yl]-2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrol-3-yl]-2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 6409303 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrol-3-yl]-2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone |
| SMILES | CCn1c2ccccc2c2nnc(SCC(=O)c3cc(C)n(-c4ccc5c(c4)OCCO5)c3C)nc21 |
| InChI | InChI=1S/C27H25N5O3S/c1-4-31-21-8-6-5-7-19(21)25-26(31)28-27(30-29-25)36-15-22(33)20-13-16(2)32(17(20)3)18-9-10-23-24(14-18)35-12-11-34-23/h5-10,13-14H,4,11-12,15H2,1-3H3 |
| InChIKey | AYQNJLJDNJOOBZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|