C30H28N2O5 — CID 4854138
[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 4854138) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 4854138 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2c3c(nc4ccccc24)CCC(C)C3)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H28N2O5/c1-17-8-10-25-23(12-17)29(21-6-4-5-7-24(21)31-25)30(34)35-15-26(33)22-13-18(2)32(19(22)3)20-9-11-27-28(14-20)37-16-36-27/h4-7,9,11,13-14,17H,8,10,12,15-16H2,1-3H3 |
| InChIKey | BGFRURCSXCDWQS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|