C23H21NO3 — CID 2490463
phenacyl (2S)-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 2490463) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is phenacyl (2S)-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | phenacyl (2S)-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 2490463 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | phenacyl (2S)-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | C[C@H]1CCc2nc3ccccc3c(C(=O)OCC(=O)c3ccccc3)c2C1 |
| InChI | InChI=1S/C23H21NO3/c1-15-11-12-20-18(13-15)22(17-9-5-6-10-19(17)24-20)23(26)27-14-21(25)16-7-3-2-4-8-16/h2-10,15H,11-14H2,1H3/t15-/m0/s1 |
| InChIKey | XEOFSYVICQNMRH-HNNXBMFYSA-N |
| XLogP | 4.40 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |