phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate

C23H21NO3 — CID 4145208

IUPACphenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate
SMILESCC1CCc2nc3ccccc3c(C(=O)OCC(=O)c3ccccc3)c2C1
InChIInChI=1S/C23H21NO3/c1-15-11-12-20-18(13-15)22(17-9-5-6-10-19(17)24-20)23(26)27-14-21(25)16-7-3-2-4-8-16/h2-10,15H,11-14H2,1H3
InChIKeyXEOFSYVICQNMRH-UHFFFAOYSA-N
MW359.43 g/mol
LogP4.40
Rot. Bonds4

About phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate

phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 4145208) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.

Molecular Properties

Compound Namephenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate
PubChem CID4145208
Molecular FormulaC23H21NO3
Molecular Weight359.43 g/mol
Exact Mass359.15
IUPAC Namephenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate
SMILESCC1CCc2nc3ccccc3c(C(=O)OCC(=O)c3ccccc3)c2C1
InChIInChI=1S/C23H21NO3/c1-15-11-12-20-18(13-15)22(17-9-5-6-10-19(17)24-20)23(26)27-14-21(25)16-7-3-2-4-8-16/h2-10,15H,11-14H2,1H3
InChIKeyXEOFSYVICQNMRH-UHFFFAOYSA-N
XLogP4.40
TPSA56.26 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500359.43
LogP ≤ 54.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate?
The IUPAC name of phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (CID 4145208) is phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
What is the SMILES notation for phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate?
The canonical SMILES for phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate is CC1CCc2nc3ccccc3c(C(=O)OCC(=O)c3ccccc3)c2C1.
What is the InChIKey of phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate?
The InChIKey is XEOFSYVICQNMRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO3/c1-15-11-12-20-18(13-15)22(17-9-5-6-10-19(17)24-20)23(26)27-14-21(25)16-7-3-2-4-8-16/h2-10,15H,11-14H2,1H3.
What are the key properties of phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate?
phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate has a molecular weight of 359.43 g/mol, XLogP of 4.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate is sourced from PubChem (CID 4145208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).