C24H20N2O7 — CID 42979488
[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 42979488) has the molecular formula C24H20N2O7 and a molecular weight of 448.43 g/mol. Its IUPAC name is [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 42979488 |
| Molecular Formula | C24H20N2O7 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | Cc1cc(C(=O)COC(=O)Cn2c(=O)oc3ccccc32)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H20N2O7/c1-14-9-17(15(2)26(14)16-7-8-21-22(10-16)32-13-31-21)19(27)12-30-23(28)11-25-18-5-3-4-6-20(18)33-24(25)29/h3-10H,11-13H2,1-2H3 |
| InChIKey | NCGGBSFHPFUOFB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 101.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|