C18H16ClF2NO6S — CID 2524424
[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 2524424) has the molecular formula C18H16ClF2NO6S and a molecular weight of 447.84 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2524424 |
| Molecular Formula | C18H16ClF2NO6S |
| Molecular Weight | 447.84 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C18H16ClF2NO6S/c1-22(2)29(25,26)13-7-8-15(19)14(9-13)17(24)27-10-16(23)11-3-5-12(6-4-11)28-18(20)21/h3-9,18H,10H2,1-2H3 |
| InChIKey | FGLJHOHNIDDGFS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |