C20H32N4O3S2 — CID 41305949
1-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 41305949) has the molecular formula C20H32N4O3S2 and a molecular weight of 440.64 g/mol. Its IUPAC name is 1-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 41305949 |
| Molecular Formula | C20H32N4O3S2 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(NC(=S)NC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C20H32N4O3S2/c1-3-24(4-2)29(25,26)17-9-10-19(23-11-5-6-12-23)18(14-17)22-20(28)21-15-16-8-7-13-27-16/h9-10,14,16H,3-8,11-13,15H2,1-2H3,(H2,21,22,28)/t16-/m1/s1 |
| InChIKey | GANASJZNRCDHDH-MRXNPFEDSA-N |
| XLogP | 2.78 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|