C26H30N4O3S2 — CID 3516620
1-(2,3-dimethylphenyl)-3-[5-[(4-methoxyphenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]thiourea (PubChem CID 3516620) has the molecular formula C26H30N4O3S2 and a molecular weight of 510.69 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[5-[(4-methoxyphenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[5-[(4-methoxyphenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]thiourea |
|---|---|
| PubChem CID | 3516620 |
| Molecular Formula | C26H30N4O3S2 |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[5-[(4-methoxyphenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]thiourea |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(N3CCCC3)c(NC(=S)Nc3cccc(C)c3C)c2)cc1 |
| InChI | InChI=1S/C26H30N4O3S2/c1-18-7-6-8-23(19(18)2)27-26(34)28-24-17-22(13-14-25(24)30-15-4-5-16-30)35(31,32)29-20-9-11-21(33-3)12-10-20/h6-14,17,29H,4-5,15-16H2,1-3H3,(H2,27,28,34) |
| InChIKey | SPCWCFZASUHSHX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|