C10H10N4O2S2 — CID 54937180
3-(1H-pyrazol-4-ylsulfonylamino)benzenecarbothioamide (PubChem CID 54937180) has the molecular formula C10H10N4O2S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 3-(1H-pyrazol-4-ylsulfonylamino)benzenecarbothioamide.
| Compound Name | 3-(1H-pyrazol-4-ylsulfonylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 54937180 |
| Molecular Formula | C10H10N4O2S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3-(1H-pyrazol-4-ylsulfonylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(NS(=O)(=O)c2cn[nH]c2)c1 |
| InChI | InChI=1S/C10H10N4O2S2/c11-10(17)7-2-1-3-8(4-7)14-18(15,16)9-5-12-13-6-9/h1-6,14H,(H2,11,17)(H,12,13) |
| InChIKey | SZGJGLUTOCUWAO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|