C16H20N2O4S2 — CID 120998917
ethyl 5-(piperidin-4-ylsulfamoyl)-1-benzothiophene-2-carboxylate (PubChem CID 120998917) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethyl 5-(piperidin-4-ylsulfamoyl)-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-(piperidin-4-ylsulfamoyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 120998917 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | ethyl 5-(piperidin-4-ylsulfamoyl)-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(S(=O)(=O)NC3CCNCC3)ccc2s1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-2-22-16(19)15-10-11-9-13(3-4-14(11)23-15)24(20,21)18-12-5-7-17-8-6-12/h3-4,9-10,12,17-18H,2,5-8H2,1H3 |
| InChIKey | ZRPPPZMTALBXOJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |