C20H27N3O5S2 — CID 55740830
ethyl 5-[(1-propylsulfonylpiperidin-4-yl)carbamoylamino]-1-benzothiophene-2-carboxylate (PubChem CID 55740830) has the molecular formula C20H27N3O5S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is ethyl 5-[(1-propylsulfonylpiperidin-4-yl)carbamoylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-[(1-propylsulfonylpiperidin-4-yl)carbamoylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 55740830 |
| Molecular Formula | C20H27N3O5S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | ethyl 5-[(1-propylsulfonylpiperidin-4-yl)carbamoylamino]-1-benzothiophene-2-carboxylate |
| SMILES | CCCS(=O)(=O)N1CCC(NC(=O)Nc2ccc3sc(C(=O)OCC)cc3c2)CC1 |
| InChI | InChI=1S/C20H27N3O5S2/c1-3-11-30(26,27)23-9-7-15(8-10-23)21-20(25)22-16-5-6-17-14(12-16)13-18(29-17)19(24)28-4-2/h5-6,12-13,15H,3-4,7-11H2,1-2H3,(H2,21,22,25) |
| InChIKey | FOOAIOIZHNNWAJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |