C14H21BrClNO2S2 — CID 80578222
5-bromo-N-(2-tert-butylcyclohexyl)-4-chlorothiophene-2-sulfonamide (PubChem CID 80578222) has the molecular formula C14H21BrClNO2S2 and a molecular weight of 414.82 g/mol. Its IUPAC name is 5-bromo-N-(2-tert-butylcyclohexyl)-4-chlorothiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(2-tert-butylcyclohexyl)-4-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80578222 |
| Molecular Formula | C14H21BrClNO2S2 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | 5-bromo-N-(2-tert-butylcyclohexyl)-4-chlorothiophene-2-sulfonamide |
| SMILES | CC(C)(C)C1CCCCC1NS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C14H21BrClNO2S2/c1-14(2,3)9-6-4-5-7-11(9)17-21(18,19)12-8-10(16)13(15)20-12/h8-9,11,17H,4-7H2,1-3H3 |
| InChIKey | RHAWUHMPINBGGU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |