C12H17BrClNO2S2 — CID 80580128
5-bromo-4-chloro-N-(2,2-dimethylcyclohexyl)thiophene-2-sulfonamide (PubChem CID 80580128) has the molecular formula C12H17BrClNO2S2 and a molecular weight of 386.76 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(2,2-dimethylcyclohexyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(2,2-dimethylcyclohexyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80580128 |
| Molecular Formula | C12H17BrClNO2S2 |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 5-bromo-4-chloro-N-(2,2-dimethylcyclohexyl)thiophene-2-sulfonamide |
| SMILES | CC1(C)CCCCC1NS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C12H17BrClNO2S2/c1-12(2)6-4-3-5-9(12)15-19(16,17)10-7-8(14)11(13)18-10/h7,9,15H,3-6H2,1-2H3 |
| InChIKey | ABCTXSKQVOTBIN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |