C11H15ClN2O4S2 — CID 80741858
5-chloro-N-(2,2-dimethylcyclopentyl)-4-nitrothiophene-2-sulfonamide (PubChem CID 80741858) has the molecular formula C11H15ClN2O4S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 5-chloro-N-(2,2-dimethylcyclopentyl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2,2-dimethylcyclopentyl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80741858 |
| Molecular Formula | C11H15ClN2O4S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 5-chloro-N-(2,2-dimethylcyclopentyl)-4-nitrothiophene-2-sulfonamide |
| SMILES | CC1(C)CCCC1NS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C11H15ClN2O4S2/c1-11(2)5-3-4-8(11)13-20(17,18)9-6-7(14(15)16)10(12)19-9/h6,8,13H,3-5H2,1-2H3 |
| InChIKey | VEDKSCVZDGGHIV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|