C9H8ClN3O6S2 — CID 80734680
5-chloro-N-(2,6-dioxopiperidin-3-yl)-4-nitrothiophene-2-sulfonamide (PubChem CID 80734680) has the molecular formula C9H8ClN3O6S2 and a molecular weight of 353.77 g/mol. Its IUPAC name is 5-chloro-N-(2,6-dioxopiperidin-3-yl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2,6-dioxopiperidin-3-yl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80734680 |
| Molecular Formula | C9H8ClN3O6S2 |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | 5-chloro-N-(2,6-dioxopiperidin-3-yl)-4-nitrothiophene-2-sulfonamide |
| SMILES | O=C1CCC(NS(=O)(=O)c2cc([N+](=O)[O-])c(Cl)s2)C(=O)N1 |
| InChI | InChI=1S/C9H8ClN3O6S2/c10-8-5(13(16)17)3-7(20-8)21(18,19)12-4-1-2-6(14)11-9(4)15/h3-4,12H,1-2H2,(H,11,14,15) |
| InChIKey | YLEAQISTYUVZEE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|