C10H11ClN2O6S2 — CID 80735922
2-[1-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]cyclobutyl]acetic acid (PubChem CID 80735922) has the molecular formula C10H11ClN2O6S2 and a molecular weight of 354.79 g/mol. Its IUPAC name is 2-[1-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 80735922 |
| Molecular Formula | C10H11ClN2O6S2 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 2-[1-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NS(=O)(=O)c2cc([N+](=O)[O-])c(Cl)s2)CCC1 |
| InChI | InChI=1S/C10H11ClN2O6S2/c11-9-6(13(16)17)4-8(20-9)21(18,19)12-10(2-1-3-10)5-7(14)15/h4,12H,1-3,5H2,(H,14,15) |
| InChIKey | ZIYSDWXHWSTJCU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|