C12H14ClNO4S — CID 79845498
2-[1-[(3-chlorophenyl)sulfonylamino]cyclobutyl]acetic acid (PubChem CID 79845498) has the molecular formula C12H14ClNO4S and a molecular weight of 303.77 g/mol. Its IUPAC name is 2-[1-[(3-chlorophenyl)sulfonylamino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(3-chlorophenyl)sulfonylamino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 79845498 |
| Molecular Formula | C12H14ClNO4S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-[1-[(3-chlorophenyl)sulfonylamino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NS(=O)(=O)c2cccc(Cl)c2)CCC1 |
| InChI | InChI=1S/C12H14ClNO4S/c13-9-3-1-4-10(7-9)19(17,18)14-12(5-2-6-12)8-11(15)16/h1,3-4,7,14H,2,5-6,8H2,(H,15,16) |
| InChIKey | ICEUCUASMHACHK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |