C10H13BrClNO3S2 — CID 80578058
5-bromo-4-chloro-N-(2-hydroxycyclohexyl)thiophene-2-sulfonamide (PubChem CID 80578058) has the molecular formula C10H13BrClNO3S2 and a molecular weight of 374.71 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(2-hydroxycyclohexyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(2-hydroxycyclohexyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80578058 |
| Molecular Formula | C10H13BrClNO3S2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 372.92 |
| IUPAC Name | 5-bromo-4-chloro-N-(2-hydroxycyclohexyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C10H13BrClNO3S2/c11-10-6(12)5-9(17-10)18(15,16)13-7-3-1-2-4-8(7)14/h5,7-8,13-14H,1-4H2 |
| InChIKey | CEIZDJDNKGDILI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |