C12H16BrClN2O2S3 — CID 80577398
2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-cyclohexylethanethioamide (PubChem CID 80577398) has the molecular formula C12H16BrClN2O2S3 and a molecular weight of 431.83 g/mol. Its IUPAC name is 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-cyclohexylethanethioamide.
| Compound Name | 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-cyclohexylethanethioamide |
|---|---|
| PubChem CID | 80577398 |
| Molecular Formula | C12H16BrClN2O2S3 |
| Molecular Weight | 431.83 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-cyclohexylethanethioamide |
| SMILES | NC(=S)C(NS(=O)(=O)c1cc(Cl)c(Br)s1)C1CCCCC1 |
| InChI | InChI=1S/C12H16BrClN2O2S3/c13-11-8(14)6-9(20-11)21(17,18)16-10(12(15)19)7-4-2-1-3-5-7/h6-7,10,16H,1-5H2,(H2,15,19) |
| InChIKey | PVGCWBWBKBGBFQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.83 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|